C28H31ClN4O5 — CID 167647923
1-[3-chloro-4-methyl-5-(morpholin-4-ylmethyl)phenyl]-3-[[2-(2,4-dioxocyclohexyl)-3-oxo-1H-isoindol-5-yl]methyl]urea (PubChem CID 167647923) has the molecular formula C28H31ClN4O5 and a molecular weight of 539.03 g/mol. Its IUPAC name is 1-[3-chloro-4-methyl-5-(morpholin-4-ylmethyl)phenyl]-3-[[2-(2,4-dioxocyclohexyl)-3-oxo-1H-isoindol-5-yl]methyl]urea.
| Compound Name | 1-[3-chloro-4-methyl-5-(morpholin-4-ylmethyl)phenyl]-3-[[2-(2,4-dioxocyclohexyl)-3-oxo-1H-isoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 167647923 |
| Molecular Formula | C28H31ClN4O5 |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 1-[3-chloro-4-methyl-5-(morpholin-4-ylmethyl)phenyl]-3-[[2-(2,4-dioxocyclohexyl)-3-oxo-1H-isoindol-5-yl]methyl]urea |
| SMILES | Cc1c(Cl)cc(NC(=O)NCc2ccc3c(c2)C(=O)N(C2CCC(=O)CC2=O)C3)cc1CN1CCOCC1 |
| InChI | InChI=1S/C28H31ClN4O5/c1-17-20(15-32-6-8-38-9-7-32)11-21(12-24(17)29)31-28(37)30-14-18-2-3-19-16-33(27(36)23(19)10-18)25-5-4-22(34)13-26(25)35/h2-3,10-12,25H,4-9,13-16H2,1H3,(H2,30,31,37) |
| InChIKey | QDNPGDGZEXHTEC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|