C28H30ClIN4O5 — CID 166074514
N-[3-chloro-5-[[iodo(oxolan-3-yl)amino]methyl]-4-methylphenyl]-3-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]propanamide (PubChem CID 166074514) has the molecular formula C28H30ClIN4O5 and a molecular weight of 664.93 g/mol. Its IUPAC name is N-[3-chloro-5-[[iodo(oxolan-3-yl)amino]methyl]-4-methylphenyl]-3-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]propanamide.
| Compound Name | N-[3-chloro-5-[[iodo(oxolan-3-yl)amino]methyl]-4-methylphenyl]-3-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]propanamide |
|---|---|
| PubChem CID | 166074514 |
| Molecular Formula | C28H30ClIN4O5 |
| Molecular Weight | 664.93 g/mol |
| Exact Mass | 664.09 |
| IUPAC Name | N-[3-chloro-5-[[iodo(oxolan-3-yl)amino]methyl]-4-methylphenyl]-3-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]propanamide |
| SMILES | Cc1c(Cl)cc(NC(=O)CCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)cc1CN(I)C1CCOC1 |
| InChI | InChI=1S/C28H30ClIN4O5/c1-16-19(14-34(30)21-8-9-39-15-21)11-20(12-23(16)29)31-25(35)6-3-17-2-4-18-13-33(28(38)22(18)10-17)24-5-7-26(36)32-27(24)37/h2,4,10-12,21,24H,3,5-9,13-15H2,1H3,(H,31,35)(H,32,36,37) |
| InChIKey | JKFXHANXIVZVHO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.93 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|