C13H17N3O4S — CID 16764818
N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide (PubChem CID 16764818) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide.
| Compound Name | N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 16764818 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide |
| SMILES | O=C1CNc2cc(NS(=O)(=O)N3CCCCC3)ccc2O1 |
| InChI | InChI=1S/C13H17N3O4S/c17-13-9-14-11-8-10(4-5-12(11)20-13)15-21(18,19)16-6-2-1-3-7-16/h4-5,8,14-15H,1-3,6-7,9H2 |
| InChIKey | BLCQJQGZOKLTSH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|