About N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide
N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide (PubChem CID 16764818) has the molecular formula C13H17N3O4S
and a molecular weight of 311.36 g/mol. Its IUPAC name is N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide |
| PubChem CID | 16764818 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide |
| SMILES | O=C1CNc2cc(NS(=O)(=O)N3CCCCC3)ccc2O1 |
| InChI | InChI=1S/C13H17N3O4S/c17-13-9-14-11-8-10(4-5-12(11)20-13)15-21(18,19)16-6-2-1-3-7-16/h4-5,8,14-15H,1-3,6-7,9H2 |
| InChIKey | BLCQJQGZOKLTSH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide?
The IUPAC name of N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide (CID 16764818) is N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide.
What is the SMILES notation for N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide?
The canonical SMILES for N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide is O=C1CNc2cc(NS(=O)(=O)N3CCCCC3)ccc2O1.
What is the InChIKey of N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide?
The InChIKey is BLCQJQGZOKLTSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O4S/c17-13-9-14-11-8-10(4-5-12(11)20-13)15-21(18,19)16-6-2-1-3-7-16/h4-5,8,14-15H,1-3,6-7,9H2.
What are the key properties of N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide?
N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide has a molecular weight of 311.36 g/mol, XLogP of 1.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxo-3,4-dihydro-1,4-benzoxazin-6-yl)piperidine-1-sulfonamide is sourced from PubChem (CID 16764818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).