C27H30O3 — CID 167655273
2-(hydroxymethyl)-4-[4-methyl-3-[2-(2-methyl-3-phenylphenyl)ethyl]phenyl]butanoic acid (PubChem CID 167655273) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-[4-methyl-3-[2-(2-methyl-3-phenylphenyl)ethyl]phenyl]butanoic acid.
| Compound Name | 2-(hydroxymethyl)-4-[4-methyl-3-[2-(2-methyl-3-phenylphenyl)ethyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 167655273 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-(hydroxymethyl)-4-[4-methyl-3-[2-(2-methyl-3-phenylphenyl)ethyl]phenyl]butanoic acid |
| SMILES | Cc1ccc(CCC(CO)C(=O)O)cc1CCc1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C27H30O3/c1-19-11-12-21(13-14-25(18-28)27(29)30)17-24(19)16-15-22-9-6-10-26(20(22)2)23-7-4-3-5-8-23/h3-12,17,25,28H,13-16,18H2,1-2H3,(H,29,30) |
| InChIKey | WGUXXGUGERKIFI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |