C18H27N5O2 — CID 167656042
7-(cyclohexylmethyl)-2-(oxan-4-ylmethoxy)imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 167656042) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 7-(cyclohexylmethyl)-2-(oxan-4-ylmethoxy)imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-(cyclohexylmethyl)-2-(oxan-4-ylmethoxy)imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 167656042 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 7-(cyclohexylmethyl)-2-(oxan-4-ylmethoxy)imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1nc(OCC2CCOCC2)nn2c(CC3CCCCC3)cnc12 |
| InChI | InChI=1S/C18H27N5O2/c19-16-17-20-11-15(10-13-4-2-1-3-5-13)23(17)22-18(21-16)25-12-14-6-8-24-9-7-14/h11,13-14H,1-10,12H2,(H2,19,21,22) |
| InChIKey | KYPLNMHQZHGVOJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|