C24H25ClN2O — CID 167657886
3-(2-chloro-3-pyridinyl)-1-[4-[4-[methyl(propyl)amino]phenyl]phenyl]propan-1-one (PubChem CID 167657886) has the molecular formula C24H25ClN2O and a molecular weight of 392.93 g/mol. Its IUPAC name is 3-(2-chloro-3-pyridinyl)-1-[4-[4-[methyl(propyl)amino]phenyl]phenyl]propan-1-one.
| Compound Name | 3-(2-chloro-3-pyridinyl)-1-[4-[4-[methyl(propyl)amino]phenyl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 167657886 |
| Molecular Formula | C24H25ClN2O |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-(2-chloro-3-pyridinyl)-1-[4-[4-[methyl(propyl)amino]phenyl]phenyl]propan-1-one |
| SMILES | CCCN(C)c1ccc(-c2ccc(C(=O)CCc3cccnc3Cl)cc2)cc1 |
| InChI | InChI=1S/C24H25ClN2O/c1-3-17-27(2)22-13-10-19(11-14-22)18-6-8-20(9-7-18)23(28)15-12-21-5-4-16-26-24(21)25/h4-11,13-14,16H,3,12,15,17H2,1-2H3 |
| InChIKey | NJBVRFAZPHQAEG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|