C24H24ClFN2O — CID 167616697
3-(2-chloro-3-pyridinyl)-1-[4-[3-fluoro-4-[methyl(propyl)amino]phenyl]phenyl]propan-1-one (PubChem CID 167616697) has the molecular formula C24H24ClFN2O and a molecular weight of 410.92 g/mol. Its IUPAC name is 3-(2-chloro-3-pyridinyl)-1-[4-[3-fluoro-4-[methyl(propyl)amino]phenyl]phenyl]propan-1-one.
| Compound Name | 3-(2-chloro-3-pyridinyl)-1-[4-[3-fluoro-4-[methyl(propyl)amino]phenyl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 167616697 |
| Molecular Formula | C24H24ClFN2O |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-(2-chloro-3-pyridinyl)-1-[4-[3-fluoro-4-[methyl(propyl)amino]phenyl]phenyl]propan-1-one |
| SMILES | CCCN(C)c1ccc(-c2ccc(C(=O)CCc3cccnc3Cl)cc2)cc1F |
| InChI | InChI=1S/C24H24ClFN2O/c1-3-15-28(2)22-12-10-20(16-21(22)26)17-6-8-18(9-7-17)23(29)13-11-19-5-4-14-27-24(19)25/h4-10,12,14,16H,3,11,13,15H2,1-2H3 |
| InChIKey | CXHLEONQYGJILR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|