C26H25F3N2O3 — CID 167554100
N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]phenyl]-2-fluorophenyl]-N-(2-methoxyethyl)propanamide (PubChem CID 167554100) has the molecular formula C26H25F3N2O3 and a molecular weight of 470.49 g/mol. Its IUPAC name is N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]phenyl]-2-fluorophenyl]-N-(2-methoxyethyl)propanamide.
| Compound Name | N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]phenyl]-2-fluorophenyl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 167554100 |
| Molecular Formula | C26H25F3N2O3 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]phenyl]-2-fluorophenyl]-N-(2-methoxyethyl)propanamide |
| SMILES | CCC(=O)N(CCOC)c1ccc(-c2ccc(C(=O)CCc3ccc(F)nc3F)cc2)cc1F |
| InChI | InChI=1S/C26H25F3N2O3/c1-3-25(33)31(14-15-34-2)22-11-8-20(16-21(22)27)17-4-6-18(7-5-17)23(32)12-9-19-10-13-24(28)30-26(19)29/h4-8,10-11,13,16H,3,9,12,14-15H2,1-2H3 |
| InChIKey | YWAPUVJIUBPDCI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|