C25H23ClF2N2O2 — CID 167558203
N-[4-[3-chloro-4-[3-(6-fluoro-2-methyl-3-pyridinyl)propanoyl]phenyl]-2-fluorophenyl]-N-methylpropanamide (PubChem CID 167558203) has the molecular formula C25H23ClF2N2O2 and a molecular weight of 456.92 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[3-(6-fluoro-2-methyl-3-pyridinyl)propanoyl]phenyl]-2-fluorophenyl]-N-methylpropanamide.
| Compound Name | N-[4-[3-chloro-4-[3-(6-fluoro-2-methyl-3-pyridinyl)propanoyl]phenyl]-2-fluorophenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 167558203 |
| Molecular Formula | C25H23ClF2N2O2 |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[4-[3-chloro-4-[3-(6-fluoro-2-methyl-3-pyridinyl)propanoyl]phenyl]-2-fluorophenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1ccc(-c2ccc(C(=O)CCc3ccc(F)nc3C)c(Cl)c2)cc1F |
| InChI | InChI=1S/C25H23ClF2N2O2/c1-4-25(32)30(3)22-10-6-18(14-21(22)27)17-5-9-19(20(26)13-17)23(31)11-7-16-8-12-24(28)29-15(16)2/h5-6,8-10,12-14H,4,7,11H2,1-3H3 |
| InChIKey | JFWOFVPGNHLBCH-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|