C25H24ClFN2O3 — CID 167542746
N-[4-[4-[3-(6-chloro-3-pyridinyl)propanoyl]-3-methoxyphenyl]-2-fluorophenyl]-N-methylpropanamide (PubChem CID 167542746) has the molecular formula C25H24ClFN2O3 and a molecular weight of 454.93 g/mol. Its IUPAC name is N-[4-[4-[3-(6-chloro-3-pyridinyl)propanoyl]-3-methoxyphenyl]-2-fluorophenyl]-N-methylpropanamide.
| Compound Name | N-[4-[4-[3-(6-chloro-3-pyridinyl)propanoyl]-3-methoxyphenyl]-2-fluorophenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 167542746 |
| Molecular Formula | C25H24ClFN2O3 |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-[4-[4-[3-(6-chloro-3-pyridinyl)propanoyl]-3-methoxyphenyl]-2-fluorophenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1ccc(-c2ccc(C(=O)CCc3ccc(Cl)nc3)c(OC)c2)cc1F |
| InChI | InChI=1S/C25H24ClFN2O3/c1-4-25(31)29(2)21-10-8-17(13-20(21)27)18-7-9-19(23(14-18)32-3)22(30)11-5-16-6-12-24(26)28-15-16/h6-10,12-15H,4-5,11H2,1-3H3 |
| InChIKey | BRVVBAMKDSUENU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|