C25H23F3N2O3 — CID 167657462
N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]-3-methoxyphenyl]-2-fluorophenyl]-N-methylpropanamide (PubChem CID 167657462) has the molecular formula C25H23F3N2O3 and a molecular weight of 456.46 g/mol. Its IUPAC name is N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]-3-methoxyphenyl]-2-fluorophenyl]-N-methylpropanamide.
| Compound Name | N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]-3-methoxyphenyl]-2-fluorophenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 167657462 |
| Molecular Formula | C25H23F3N2O3 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]-3-methoxyphenyl]-2-fluorophenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1ccc(-c2ccc(C(=O)CCc3ccc(F)nc3F)c(OC)c2)cc1F |
| InChI | InChI=1S/C25H23F3N2O3/c1-4-24(32)30(2)20-10-6-16(13-19(20)26)17-5-9-18(22(14-17)33-3)21(31)11-7-15-8-12-23(27)29-25(15)28/h5-6,8-10,12-14H,4,7,11H2,1-3H3 |
| InChIKey | CEGBHNVVJYKHGI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|