C24H22ClFN2O3 — CID 167711956
N-[4-[4-[3-(6-chloro-3-pyridinyl)propanoyl]-3-hydroxyphenyl]-2-fluorophenyl]-N-methylpropanamide (PubChem CID 167711956) has the molecular formula C24H22ClFN2O3 and a molecular weight of 440.90 g/mol. Its IUPAC name is N-[4-[4-[3-(6-chloro-3-pyridinyl)propanoyl]-3-hydroxyphenyl]-2-fluorophenyl]-N-methylpropanamide.
| Compound Name | N-[4-[4-[3-(6-chloro-3-pyridinyl)propanoyl]-3-hydroxyphenyl]-2-fluorophenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 167711956 |
| Molecular Formula | C24H22ClFN2O3 |
| Molecular Weight | 440.90 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[4-[4-[3-(6-chloro-3-pyridinyl)propanoyl]-3-hydroxyphenyl]-2-fluorophenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1ccc(-c2ccc(C(=O)CCc3ccc(Cl)nc3)c(O)c2)cc1F |
| InChI | InChI=1S/C24H22ClFN2O3/c1-3-24(31)28(2)20-9-7-16(12-19(20)26)17-6-8-18(22(30)13-17)21(29)10-4-15-5-11-23(25)27-14-15/h5-9,11-14,30H,3-4,10H2,1-2H3 |
| InChIKey | WGCPWHDGCLZUNW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|