C25H24F2N2O2 — CID 167595216
N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]-2-methylphenyl]phenyl]-N-methylpropanamide (PubChem CID 167595216) has the molecular formula C25H24F2N2O2 and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]-2-methylphenyl]phenyl]-N-methylpropanamide.
| Compound Name | N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]-2-methylphenyl]phenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 167595216 |
| Molecular Formula | C25H24F2N2O2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[4-[4-[3-(2,6-difluoro-3-pyridinyl)propanoyl]-2-methylphenyl]phenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1ccc(-c2ccc(C(=O)CCc3ccc(F)nc3F)cc2C)cc1 |
| InChI | InChI=1S/C25H24F2N2O2/c1-4-24(31)29(3)20-10-5-17(6-11-20)21-12-7-19(15-16(21)2)22(30)13-8-18-9-14-23(26)28-25(18)27/h5-7,9-12,14-15H,4,8,13H2,1-3H3 |
| InChIKey | MNRHZYOVHHMAER-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|