C23H28F2N4O2 — CID 167539534
N-[2-fluoro-4-[4-[3-(6-fluoro-2-methyl-3-pyridinyl)propanoyl]piperazin-1-yl]phenyl]-N-methylpropanamide (PubChem CID 167539534) has the molecular formula C23H28F2N4O2 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[2-fluoro-4-[4-[3-(6-fluoro-2-methyl-3-pyridinyl)propanoyl]piperazin-1-yl]phenyl]-N-methylpropanamide.
| Compound Name | N-[2-fluoro-4-[4-[3-(6-fluoro-2-methyl-3-pyridinyl)propanoyl]piperazin-1-yl]phenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 167539534 |
| Molecular Formula | C23H28F2N4O2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | N-[2-fluoro-4-[4-[3-(6-fluoro-2-methyl-3-pyridinyl)propanoyl]piperazin-1-yl]phenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1ccc(N2CCN(C(=O)CCc3ccc(F)nc3C)CC2)cc1F |
| InChI | InChI=1S/C23H28F2N4O2/c1-4-22(30)27(3)20-8-7-18(15-19(20)24)28-11-13-29(14-12-28)23(31)10-6-17-5-9-21(25)26-16(17)2/h5,7-9,15H,4,6,10-14H2,1-3H3 |
| InChIKey | BPVIRVHUAADQNQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|