C22H26F2N4O2 — CID 167606300
N-[2-fluoro-4-[4-[3-(2-fluoro-3-pyridinyl)propanoyl]piperazin-1-yl]phenyl]-N-methylpropanamide (PubChem CID 167606300) has the molecular formula C22H26F2N4O2 and a molecular weight of 416.47 g/mol. Its IUPAC name is N-[2-fluoro-4-[4-[3-(2-fluoro-3-pyridinyl)propanoyl]piperazin-1-yl]phenyl]-N-methylpropanamide.
| Compound Name | N-[2-fluoro-4-[4-[3-(2-fluoro-3-pyridinyl)propanoyl]piperazin-1-yl]phenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 167606300 |
| Molecular Formula | C22H26F2N4O2 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-[2-fluoro-4-[4-[3-(2-fluoro-3-pyridinyl)propanoyl]piperazin-1-yl]phenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1ccc(N2CCN(C(=O)CCc3cccnc3F)CC2)cc1F |
| InChI | InChI=1S/C22H26F2N4O2/c1-3-20(29)26(2)19-8-7-17(15-18(19)23)27-11-13-28(14-12-27)21(30)9-6-16-5-4-10-25-22(16)24/h4-5,7-8,10,15H,3,6,9,11-14H2,1-2H3 |
| InChIKey | KXZBNANQPDBWJN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|