C15H22BNO2 — CID 167658164
[(1S,3R)-3-benzamidocyclohexyl]methyl-methylborinic acid (PubChem CID 167658164) has the molecular formula C15H22BNO2 and a molecular weight of 259.16 g/mol. Its IUPAC name is [(1S,3R)-3-benzamidocyclohexyl]methyl-methylborinic acid.
| Compound Name | [(1S,3R)-3-benzamidocyclohexyl]methyl-methylborinic acid |
|---|---|
| PubChem CID | 167658164 |
| Molecular Formula | C15H22BNO2 |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | [(1S,3R)-3-benzamidocyclohexyl]methyl-methylborinic acid |
| SMILES | CB(O)C[C@H]1CCC[C@@H](NC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C15H22BNO2/c1-16(19)11-12-6-5-9-14(10-12)17-15(18)13-7-3-2-4-8-13/h2-4,7-8,12,14,19H,5-6,9-11H2,1H3,(H,17,18)/t12-,14+/m0/s1 |
| InChIKey | QODRFXQLSBBKIX-GXTWGEPZSA-N |
| XLogP | 2.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|