C16H25BrN2O2 — CID 16766052
N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-1-piperidin-4-ylmethanamine (PubChem CID 16766052) has the molecular formula C16H25BrN2O2 and a molecular weight of 357.29 g/mol. Its IUPAC name is N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-1-piperidin-4-ylmethanamine.
| Compound Name | N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-1-piperidin-4-ylmethanamine |
|---|---|
| PubChem CID | 16766052 |
| Molecular Formula | C16H25BrN2O2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-1-piperidin-4-ylmethanamine |
| SMILES | CCOc1cc(CNCC2CCNCC2)cc(Br)c1OC |
| InChI | InChI=1S/C16H25BrN2O2/c1-3-21-15-9-13(8-14(17)16(15)20-2)11-19-10-12-4-6-18-7-5-12/h8-9,12,18-19H,3-7,10-11H2,1-2H3 |
| InChIKey | PAOOPQNDGSEGML-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |