C38H44BBrN4O8 — CID 167661246
methyl 5-[4-[acetyl(methyl)amino]phenyl]pyridine-2-carboxylate;methyl 5-bromopyridine-2-carboxylate;N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (PubChem CID 167661246) has the molecular formula C38H44BBrN4O8 and a molecular weight of 775.51 g/mol. Its IUPAC name is methyl 5-[4-[acetyl(methyl)amino]phenyl]pyridine-2-carboxylate;methyl 5-bromopyridine-2-carboxylate;N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide.
| Compound Name | methyl 5-[4-[acetyl(methyl)amino]phenyl]pyridine-2-carboxylate;methyl 5-bromopyridine-2-carboxylate;N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 167661246 |
| Molecular Formula | C38H44BBrN4O8 |
| Molecular Weight | 775.51 g/mol |
| Exact Mass | 774.24 |
| IUPAC Name | methyl 5-[4-[acetyl(methyl)amino]phenyl]pyridine-2-carboxylate;methyl 5-bromopyridine-2-carboxylate;N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| SMILES | CC(=O)N(C)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1.COC(=O)c1ccc(-c2ccc(N(C)C(C)=O)cc2)cn1.COC(=O)c1ccc(Br)cn1 |
| InChI | InChI=1S/C16H16N2O3.C15H22BNO3.C7H6BrNO2/c1-11(19)18(2)14-7-4-12(5-8-14)13-6-9-15(17-10-13)16(20)21-3;1-11(18)17(6)13-9-7-12(8-10-13)16-19-14(2,3)15(4,5)20-16;1-11-7(10)6-3-2-5(8)4-9-6/h4-10H,1-3H3;7-10H,1-6H3;2-4H,1H3 |
| InChIKey | RZJBATKVHLGSQO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 137.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|