C20H28F2N4O6S2 — CID 167662784
4-amino-N-tert-butyl-3-fluorobenzenesulfonamide;N-tert-butyl-3-fluoro-4-nitrobenzenesulfonamide (PubChem CID 167662784) has the molecular formula C20H28F2N4O6S2 and a molecular weight of 522.60 g/mol. Its IUPAC name is 4-amino-N-tert-butyl-3-fluorobenzenesulfonamide;N-tert-butyl-3-fluoro-4-nitrobenzenesulfonamide.
| Compound Name | 4-amino-N-tert-butyl-3-fluorobenzenesulfonamide;N-tert-butyl-3-fluoro-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 167662784 |
| Molecular Formula | C20H28F2N4O6S2 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 4-amino-N-tert-butyl-3-fluorobenzenesulfonamide;N-tert-butyl-3-fluoro-4-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(N)c(F)c1.CC(C)(C)NS(=O)(=O)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C10H13FN2O4S.C10H15FN2O2S/c1-10(2,3)12-18(16,17)7-4-5-9(13(14)15)8(11)6-7;1-10(2,3)13-16(14,15)7-4-5-9(12)8(11)6-7/h4-6,12H,1-3H3;4-6,13H,12H2,1-3H3 |
| InChIKey | SENNQRXBLMIBDR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|