C16H16F2N2O5S — CID 9195995
N-tert-butyl-4-(3,4-difluorophenoxy)-3-nitrobenzenesulfonamide (PubChem CID 9195995) has the molecular formula C16H16F2N2O5S and a molecular weight of 386.38 g/mol. Its IUPAC name is N-tert-butyl-4-(3,4-difluorophenoxy)-3-nitrobenzenesulfonamide.
| Compound Name | N-tert-butyl-4-(3,4-difluorophenoxy)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9195995 |
| Molecular Formula | C16H16F2N2O5S |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-tert-butyl-4-(3,4-difluorophenoxy)-3-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(Oc2ccc(F)c(F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16F2N2O5S/c1-16(2,3)19-26(23,24)11-5-7-15(14(9-11)20(21)22)25-10-4-6-12(17)13(18)8-10/h4-9,19H,1-3H3 |
| InChIKey | GMXPLHCJURZTFW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|