C15H19NO — CID 167666046
3-(3-tert-butylphenyl)-N,N-dimethylprop-2-ynamide (PubChem CID 167666046) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-(3-tert-butylphenyl)-N,N-dimethylprop-2-ynamide.
| Compound Name | 3-(3-tert-butylphenyl)-N,N-dimethylprop-2-ynamide |
|---|---|
| PubChem CID | 167666046 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 3-(3-tert-butylphenyl)-N,N-dimethylprop-2-ynamide |
| SMILES | CN(C)C(=O)C#Cc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H19NO/c1-15(2,3)13-8-6-7-12(11-13)9-10-14(17)16(4)5/h6-8,11H,1-5H3 |
| InChIKey | UTXXCPQDULNUIH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|