C43H29N3Se — CID 167666212
2-[4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]-6-phenylbenzeneselenol (PubChem CID 167666212) has the molecular formula C43H29N3Se and a molecular weight of 666.69 g/mol. Its IUPAC name is 2-[4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]-6-phenylbenzeneselenol.
| Compound Name | 2-[4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]-6-phenylbenzeneselenol |
|---|---|
| PubChem CID | 167666212 |
| Molecular Formula | C43H29N3Se |
| Molecular Weight | 666.69 g/mol |
| Exact Mass | 667.15 |
| IUPAC Name | 2-[4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]phenyl]-6-phenylbenzeneselenol |
| SMILES | [SeH]c1c(-c2ccccc2)cccc1-c1ccc(-c2cccc3c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cccc23)cc1 |
| InChI | InChI=1S/C43H29N3Se/c47-40-35(29-13-4-1-5-14-29)20-11-21-36(40)31-27-25-30(26-28-31)34-19-10-23-38-37(34)22-12-24-39(38)43-45-41(32-15-6-2-7-16-32)44-42(46-43)33-17-8-3-9-18-33/h1-28,47H |
| InChIKey | KCVULAYWNMYIFX-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.69 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|