C21H28N6O — CID 167668113
3-(11-cyclohexyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-3-yl)-N-[2-(methylamino)prop-2-enyl]propanamide (PubChem CID 167668113) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is 3-(11-cyclohexyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-3-yl)-N-[2-(methylamino)prop-2-enyl]propanamide.
| Compound Name | 3-(11-cyclohexyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-3-yl)-N-[2-(methylamino)prop-2-enyl]propanamide |
|---|---|
| PubChem CID | 167668113 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 3-(11-cyclohexyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-3-yl)-N-[2-(methylamino)prop-2-enyl]propanamide |
| SMILES | C=C(CNC(=O)CCc1c[nH]c2ncc3nc(C4CCCCC4)cn3c12)NC |
| InChI | InChI=1S/C21H28N6O/c1-14(22-2)10-23-19(28)9-8-16-11-24-21-20(16)27-13-17(26-18(27)12-25-21)15-6-4-3-5-7-15/h11-13,15,22,24H,1,3-10H2,2H3,(H,23,28) |
| InChIKey | VYGZGYZVDDZZRE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |