C21H17F3N2O4S — CID 167672476
4-ethyl-3-[[2-pyrimidin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid (PubChem CID 167672476) has the molecular formula C21H17F3N2O4S and a molecular weight of 450.44 g/mol. Its IUPAC name is 4-ethyl-3-[[2-pyrimidin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid.
| Compound Name | 4-ethyl-3-[[2-pyrimidin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 167672476 |
| Molecular Formula | C21H17F3N2O4S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 4-ethyl-3-[[2-pyrimidin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Cc1cc(C(F)(F)F)ccc1-c1ncccn1 |
| InChI | InChI=1S/C21H17F3N2O4S/c1-2-13-4-5-14(20(27)28)11-18(13)31(29,30)12-15-10-16(21(22,23)24)6-7-17(15)19-25-8-3-9-26-19/h3-11H,2,12H2,1H3,(H,27,28) |
| InChIKey | YBNHWJHLLVAIKN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |