C19H12N2O6S — CID 42628097
6-(2-methoxypyrimidin-5-yl)-9,10,10-trioxothioxanthene-1-carboxylic acid (PubChem CID 42628097) has the molecular formula C19H12N2O6S and a molecular weight of 396.38 g/mol. Its IUPAC name is 6-(2-methoxypyrimidin-5-yl)-9,10,10-trioxothioxanthene-1-carboxylic acid.
| Compound Name | 6-(2-methoxypyrimidin-5-yl)-9,10,10-trioxothioxanthene-1-carboxylic acid |
|---|---|
| PubChem CID | 42628097 |
| Molecular Formula | C19H12N2O6S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 6-(2-methoxypyrimidin-5-yl)-9,10,10-trioxothioxanthene-1-carboxylic acid |
| SMILES | COc1ncc(-c2ccc3c(c2)S(=O)(=O)c2cccc(C(=O)O)c2C3=O)cn1 |
| InChI | InChI=1S/C19H12N2O6S/c1-27-19-20-8-11(9-21-19)10-5-6-12-15(7-10)28(25,26)14-4-2-3-13(18(23)24)16(14)17(12)22/h2-9H,1H3,(H,23,24) |
| InChIKey | BJRLURDIWIUSSP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |