C22H19N5O4S — CID 167672985
4-cyclopropyl-3-[[2-pyrrol-1-yl-5-(tetrazol-1-yl)phenyl]methylsulfonyl]benzoic acid (PubChem CID 167672985) has the molecular formula C22H19N5O4S and a molecular weight of 449.49 g/mol. Its IUPAC name is 4-cyclopropyl-3-[[2-pyrrol-1-yl-5-(tetrazol-1-yl)phenyl]methylsulfonyl]benzoic acid.
| Compound Name | 4-cyclopropyl-3-[[2-pyrrol-1-yl-5-(tetrazol-1-yl)phenyl]methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 167672985 |
| Molecular Formula | C22H19N5O4S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 4-cyclopropyl-3-[[2-pyrrol-1-yl-5-(tetrazol-1-yl)phenyl]methylsulfonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2CC2)c(S(=O)(=O)Cc2cc(-n3cnnn3)ccc2-n2cccc2)c1 |
| InChI | InChI=1S/C22H19N5O4S/c28-22(29)16-5-7-19(15-3-4-15)21(12-16)32(30,31)13-17-11-18(27-14-23-24-25-27)6-8-20(17)26-9-1-2-10-26/h1-2,5-12,14-15H,3-4,13H2,(H,28,29) |
| InChIKey | XJKYIMSFXPQTIZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |