C14H20N2O4Si — CID 16767601
trimethyl-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]silane (PubChem CID 16767601) has the molecular formula C14H20N2O4Si and a molecular weight of 308.41 g/mol. Its IUPAC name is trimethyl-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]silane.
| Compound Name | trimethyl-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]silane |
|---|---|
| PubChem CID | 16767601 |
| Molecular Formula | C14H20N2O4Si |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | trimethyl-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]silane |
| SMILES | COc1cc(-c2nnc([Si](C)(C)C)o2)cc(OC)c1OC |
| InChI | InChI=1S/C14H20N2O4Si/c1-17-10-7-9(8-11(18-2)12(10)19-3)13-15-16-14(20-13)21(4,5)6/h7-8H,1-6H3 |
| InChIKey | VNFGRNKORFASAE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|