C23H42O13 — CID 167676397
propan-2-yl 2-(6-ethyl-2,4,5-trihydroxyoxan-3-yl)acetate;propan-2-yl 2-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetate (PubChem CID 167676397) has the molecular formula C23H42O13 and a molecular weight of 526.58 g/mol. Its IUPAC name is propan-2-yl 2-(6-ethyl-2,4,5-trihydroxyoxan-3-yl)acetate;propan-2-yl 2-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetate.
| Compound Name | propan-2-yl 2-(6-ethyl-2,4,5-trihydroxyoxan-3-yl)acetate;propan-2-yl 2-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetate |
|---|---|
| PubChem CID | 167676397 |
| Molecular Formula | C23H42O13 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | propan-2-yl 2-(6-ethyl-2,4,5-trihydroxyoxan-3-yl)acetate;propan-2-yl 2-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetate |
| SMILES | CC(C)OC(=O)C[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O.CCC1OC(O)C(CC(=O)OC(C)C)C(O)C1O |
| InChI | InChI=1S/C12H22O6.C11H20O7/c1-4-8-11(15)10(14)7(12(16)18-8)5-9(13)17-6(2)3;1-5(2)17-8(13)3-6-9(14)10(15)7(4-12)18-11(6)16/h6-8,10-12,14-16H,4-5H2,1-3H3;5-7,9-12,14-16H,3-4H2,1-2H3/t;6-,7-,9-,10-,11?/m.1/s1 |
| InChIKey | UWMVXLUWXVXKCE-JXTAKKKJSA-N |
| XLogP | -1.83 |
| TPSA | 212.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |