C32H37N — CID 167681483
2-methylnaphthalene;3-methyl-9-octylcarbazole (PubChem CID 167681483) has the molecular formula C32H37N and a molecular weight of 435.66 g/mol. Its IUPAC name is 2-methylnaphthalene;3-methyl-9-octylcarbazole.
| Compound Name | 2-methylnaphthalene;3-methyl-9-octylcarbazole |
|---|---|
| PubChem CID | 167681483 |
| Molecular Formula | C32H37N |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 2-methylnaphthalene;3-methyl-9-octylcarbazole |
| SMILES | CCCCCCCCn1c2ccccc2c2cc(C)ccc21.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H27N.C11H10/c1-3-4-5-6-7-10-15-22-20-12-9-8-11-18(20)19-16-17(2)13-14-21(19)22;1-9-6-7-10-4-2-3-5-11(10)8-9/h8-9,11-14,16H,3-7,10,15H2,1-2H3;2-8H,1H3 |
| InChIKey | VPJXDESIXSOTQK-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|