C10H8F3NO2S — CID 167686431
2-(2,2,2-trifluoroethylsulfonylmethyl)benzonitrile (PubChem CID 167686431) has the molecular formula C10H8F3NO2S and a molecular weight of 263.24 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfonylmethyl)benzonitrile.
| Compound Name | 2-(2,2,2-trifluoroethylsulfonylmethyl)benzonitrile |
|---|---|
| PubChem CID | 167686431 |
| Molecular Formula | C10H8F3NO2S |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 2-(2,2,2-trifluoroethylsulfonylmethyl)benzonitrile |
| SMILES | N#Cc1ccccc1CS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H8F3NO2S/c11-10(12,13)7-17(15,16)6-9-4-2-1-3-8(9)5-14/h1-4H,6-7H2 |
| InChIKey | WHDPTXRTMCRQBS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |