C10H9F3N2O3S — CID 82714915
1-(2-cyanophenyl)-N-(2,2,2-trifluoroethoxy)methanesulfonamide (PubChem CID 82714915) has the molecular formula C10H9F3N2O3S and a molecular weight of 294.25 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-N-(2,2,2-trifluoroethoxy)methanesulfonamide.
| Compound Name | 1-(2-cyanophenyl)-N-(2,2,2-trifluoroethoxy)methanesulfonamide |
|---|---|
| PubChem CID | 82714915 |
| Molecular Formula | C10H9F3N2O3S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 1-(2-cyanophenyl)-N-(2,2,2-trifluoroethoxy)methanesulfonamide |
| SMILES | N#Cc1ccccc1CS(=O)(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O3S/c11-10(12,13)7-18-15-19(16,17)6-9-4-2-1-3-8(9)5-14/h1-4,15H,6-7H2 |
| InChIKey | GHXCGGRPEPYVPX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|