C21H22F2N2O6 — CID 167691108
5-[3-(2,2-difluorobutoxy)cyclobutyl]oxy-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167691108) has the molecular formula C21H22F2N2O6 and a molecular weight of 436.41 g/mol. Its IUPAC name is 5-[3-(2,2-difluorobutoxy)cyclobutyl]oxy-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-(2,2-difluorobutoxy)cyclobutyl]oxy-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167691108 |
| Molecular Formula | C21H22F2N2O6 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 5-[3-(2,2-difluorobutoxy)cyclobutyl]oxy-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCC(F)(F)COC1CC(Oc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C21H22F2N2O6/c1-2-21(22,23)10-30-12-7-13(8-12)31-11-3-4-14-15(9-11)20(29)25(19(14)28)16-5-6-17(26)24-18(16)27/h3-4,9,12-13,16H,2,5-8,10H2,1H3,(H,24,26,27) |
| InChIKey | RCZBJNJOWXICMU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|