C20H20F2N2O7 — CID 165371283
5-[3-(2,2-difluoro-3-hydroxypropoxy)cyclobutyl]oxy-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 165371283) has the molecular formula C20H20F2N2O7 and a molecular weight of 438.38 g/mol. Its IUPAC name is 5-[3-(2,2-difluoro-3-hydroxypropoxy)cyclobutyl]oxy-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-(2,2-difluoro-3-hydroxypropoxy)cyclobutyl]oxy-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 165371283 |
| Molecular Formula | C20H20F2N2O7 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 5-[3-(2,2-difluoro-3-hydroxypropoxy)cyclobutyl]oxy-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OC4CC(OCC(F)(F)CO)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H20F2N2O7/c21-20(22,8-25)9-30-11-5-12(6-11)31-10-1-2-13-14(7-10)19(29)24(18(13)28)15-3-4-16(26)23-17(15)27/h1-2,7,11-12,15,25H,3-6,8-9H2,(H,23,26,27) |
| InChIKey | ZLMNGIHSFJYJFT-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|