C23H27N5O2 — CID 167691380
1-[3-amino-6-(4-propylphenyl)pyrazin-2-yl]-2-[4-(3-hydroxypropylamino)-3-pyridinyl]ethanone (PubChem CID 167691380) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-[3-amino-6-(4-propylphenyl)pyrazin-2-yl]-2-[4-(3-hydroxypropylamino)-3-pyridinyl]ethanone.
| Compound Name | 1-[3-amino-6-(4-propylphenyl)pyrazin-2-yl]-2-[4-(3-hydroxypropylamino)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 167691380 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-[3-amino-6-(4-propylphenyl)pyrazin-2-yl]-2-[4-(3-hydroxypropylamino)-3-pyridinyl]ethanone |
| SMILES | CCCc1ccc(-c2cnc(N)c(C(=O)Cc3cnccc3NCCCO)n2)cc1 |
| InChI | InChI=1S/C23H27N5O2/c1-2-4-16-5-7-17(8-6-16)20-15-27-23(24)22(28-20)21(30)13-18-14-25-11-9-19(18)26-10-3-12-29/h5-9,11,14-15,29H,2-4,10,12-13H2,1H3,(H2,24,27)(H,25,26) |
| InChIKey | WZQZAVVVQUZADV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|