C18H22FN3O — CID 167692782
6-(cyclopropylmethyl)-2-fluoro-3-[1-(oxetan-3-yl)-4-propan-2-ylpyrazol-5-yl]pyridine (PubChem CID 167692782) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is 6-(cyclopropylmethyl)-2-fluoro-3-[1-(oxetan-3-yl)-4-propan-2-ylpyrazol-5-yl]pyridine.
| Compound Name | 6-(cyclopropylmethyl)-2-fluoro-3-[1-(oxetan-3-yl)-4-propan-2-ylpyrazol-5-yl]pyridine |
|---|---|
| PubChem CID | 167692782 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 6-(cyclopropylmethyl)-2-fluoro-3-[1-(oxetan-3-yl)-4-propan-2-ylpyrazol-5-yl]pyridine |
| SMILES | CC(C)c1cnn(C2COC2)c1-c1ccc(CC2CC2)nc1F |
| InChI | InChI=1S/C18H22FN3O/c1-11(2)16-8-20-22(14-9-23-10-14)17(16)15-6-5-13(21-18(15)19)7-12-3-4-12/h5-6,8,11-12,14H,3-4,7,9-10H2,1-2H3 |
| InChIKey | XEVQKPINDBDZGH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|