C15H17FN4OS — CID 167271296
N-cyclopropyl-6-fluoro-5-[4-methylsulfanyl-1-(oxetan-3-yl)pyrazol-3-yl]pyridin-2-amine (PubChem CID 167271296) has the molecular formula C15H17FN4OS and a molecular weight of 320.39 g/mol. Its IUPAC name is N-cyclopropyl-6-fluoro-5-[4-methylsulfanyl-1-(oxetan-3-yl)pyrazol-3-yl]pyridin-2-amine.
| Compound Name | N-cyclopropyl-6-fluoro-5-[4-methylsulfanyl-1-(oxetan-3-yl)pyrazol-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 167271296 |
| Molecular Formula | C15H17FN4OS |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-cyclopropyl-6-fluoro-5-[4-methylsulfanyl-1-(oxetan-3-yl)pyrazol-3-yl]pyridin-2-amine |
| SMILES | CSc1cn(C2COC2)nc1-c1ccc(NC2CC2)nc1F |
| InChI | InChI=1S/C15H17FN4OS/c1-22-12-6-20(10-7-21-8-10)19-14(12)11-4-5-13(18-15(11)16)17-9-2-3-9/h4-6,9-10H,2-3,7-8H2,1H3,(H,17,18) |
| InChIKey | ZFXDOSOKZOJTBK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|