About 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide
6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide (PubChem CID 167693011) has the molecular formula C18H14BrNO3
and a molecular weight of 372.22 g/mol. Its IUPAC name is 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide.
Molecular Properties
| Compound Name | 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide |
| PubChem CID | 167693011 |
| Molecular Formula | C18H14BrNO3 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide |
| SMILES | CC(c1ccccc1)n1ccc2cc(Br)ccc2c1=O.O=C=O |
| InChI | InChI=1S/C17H14BrNO.CO2/c1-12(13-5-3-2-4-6-13)19-10-9-14-11-15(18)7-8-16(14)17(19)20;2-1-3/h2-12H,1H3; |
| InChIKey | XFRVCEFAVQIHHH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide?
The IUPAC name of 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide (CID 167693011) is 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide.
What is the SMILES notation for 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide?
The canonical SMILES for 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide is CC(c1ccccc1)n1ccc2cc(Br)ccc2c1=O.O=C=O.
What is the InChIKey of 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide?
The InChIKey is XFRVCEFAVQIHHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrNO.CO2/c1-12(13-5-3-2-4-6-13)19-10-9-14-11-15(18)7-8-16(14)17(19)20;2-1-3/h2-12H,1H3;.
What are the key properties of 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide?
6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide has a molecular weight of 372.22 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(1-phenylethyl)isoquinolin-1-one;carbon dioxide is sourced from PubChem (CID 167693011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).