About 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one
5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one (PubChem CID 167693659) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one |
| PubChem CID | 167693659 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one |
| SMILES | C=C1NC(=O)C(C(C)C)C1C(C)C |
| InChI | InChI=1S/C11H19NO/c1-6(2)9-8(5)12-11(13)10(9)7(3)4/h6-7,9-10H,5H2,1-4H3,(H,12,13) |
| InChIKey | LEMMRCYPSWWQQH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one?
The IUPAC name of 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one (CID 167693659) is 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one.
What is the SMILES notation for 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one?
The canonical SMILES for 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one is C=C1NC(=O)C(C(C)C)C1C(C)C.
What is the InChIKey of 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one?
The InChIKey is LEMMRCYPSWWQQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-6(2)9-8(5)12-11(13)10(9)7(3)4/h6-7,9-10H,5H2,1-4H3,(H,12,13).
What are the key properties of 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one?
5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one has a molecular weight of 181.28 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidene-3,4-di(propan-2-yl)pyrrolidin-2-one is sourced from PubChem (CID 167693659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).