N-butyl-N-ethylsulfamoyl chloride

C6H14ClNO2S — CID 16769495

IUPACN-butyl-N-ethylsulfamoyl chloride
SMILESCCCCN(CC)S(=O)(=O)Cl
InChIInChI=1S/C6H14ClNO2S/c1-3-5-6-8(4-2)11(7,9)10/h3-6H2,1-2H3
InChIKeyLXHNLXVYSVNGAV-UHFFFAOYSA-N
MW199.70 g/mol
LogP1.59
Rot. Bonds5

About N-butyl-N-ethylsulfamoyl chloride

N-butyl-N-ethylsulfamoyl chloride (PubChem CID 16769495) has the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. Its IUPAC name is N-butyl-N-ethylsulfamoyl chloride.

Molecular Properties

Compound NameN-butyl-N-ethylsulfamoyl chloride
PubChem CID16769495
Molecular FormulaC6H14ClNO2S
Molecular Weight199.70 g/mol
Exact Mass199.04
IUPAC NameN-butyl-N-ethylsulfamoyl chloride
SMILESCCCCN(CC)S(=O)(=O)Cl
InChIInChI=1S/C6H14ClNO2S/c1-3-5-6-8(4-2)11(7,9)10/h3-6H2,1-2H3
InChIKeyLXHNLXVYSVNGAV-UHFFFAOYSA-N
XLogP1.59
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.70
LogP ≤ 51.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N-butyl-N-ethylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

N,N-diethylsulfamoyl chloride
CID 11252267
1-Pyrrolidinesulfonyl chloride
CID 6483902
N,N-dibutylsulfamoyl chloride
CID 3815528
N-methyl-N-propylsulfamoyl chloride
CID 12919367
N,N-dipropylsulfamoyl chloride
CID 16228222
N-butyl-N-methylsulfamoyl chloride
CID 16770019
N-Methyl-N-(2-methylpropyl)sulfamoyl chloride
CID 43272017
N-(cyclopropylmethyl)-N-propylsulfamoyl chloride
CID 16770038
N-ethyl-N-(propan-2-yl)sulfamoyl chloride
CID 43265685
N-ethyl-N-propylsulfamoyl chloride
CID 43268661
N-(butan-2-yl)-N-methylsulfamoyl chloride
CID 43272832
Methylpentylsulfamoyl chloride
CID 43294741

Frequently Asked Questions

What is the IUPAC name of N-butyl-N-ethylsulfamoyl chloride?
The IUPAC name of N-butyl-N-ethylsulfamoyl chloride (CID 16769495) is N-butyl-N-ethylsulfamoyl chloride.
What is the SMILES notation for N-butyl-N-ethylsulfamoyl chloride?
The canonical SMILES for N-butyl-N-ethylsulfamoyl chloride is CCCCN(CC)S(=O)(=O)Cl.
What is the InChIKey of N-butyl-N-ethylsulfamoyl chloride?
The InChIKey is LXHNLXVYSVNGAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14ClNO2S/c1-3-5-6-8(4-2)11(7,9)10/h3-6H2,1-2H3.
What are the key properties of N-butyl-N-ethylsulfamoyl chloride?
N-butyl-N-ethylsulfamoyl chloride has a molecular weight of 199.70 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-ethylsulfamoyl chloride is sourced from PubChem (CID 16769495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).