C13H13NO3S — CID 16769568
5-ethoxy-2-(1,3-thiazol-4-ylmethoxy)benzaldehyde (PubChem CID 16769568) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 5-ethoxy-2-(1,3-thiazol-4-ylmethoxy)benzaldehyde.
| Compound Name | 5-ethoxy-2-(1,3-thiazol-4-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 16769568 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-ethoxy-2-(1,3-thiazol-4-ylmethoxy)benzaldehyde |
| SMILES | CCOc1ccc(OCc2cscn2)c(C=O)c1 |
| InChI | InChI=1S/C13H13NO3S/c1-2-16-12-3-4-13(10(5-12)6-15)17-7-11-8-18-9-14-11/h3-6,8-9H,2,7H2,1H3 |
| InChIKey | IHQYQIXIYHWLQK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|