C12H13NO3S — CID 43267936
[5-methoxy-2-(1,3-thiazol-4-ylmethoxy)phenyl]methanol (PubChem CID 43267936) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is [5-methoxy-2-(1,3-thiazol-4-ylmethoxy)phenyl]methanol.
| Compound Name | [5-methoxy-2-(1,3-thiazol-4-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 43267936 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | [5-methoxy-2-(1,3-thiazol-4-ylmethoxy)phenyl]methanol |
| SMILES | COc1ccc(OCc2cscn2)c(CO)c1 |
| InChI | InChI=1S/C12H13NO3S/c1-15-11-2-3-12(9(4-11)5-14)16-6-10-7-17-8-13-10/h2-4,7-8,14H,5-6H2,1H3 |
| InChIKey | KWCPTRLVESHALF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |