C8H16F3N3O3 — CID 167697350
tert-butyl (2S,3R)-2-azido-3-hydroxybutanoate;molecular fluorine;hydrofluoride (PubChem CID 167697350) has the molecular formula C8H16F3N3O3 and a molecular weight of 259.23 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-azido-3-hydroxybutanoate;molecular fluorine;hydrofluoride.
| Compound Name | tert-butyl (2S,3R)-2-azido-3-hydroxybutanoate;molecular fluorine;hydrofluoride |
|---|---|
| PubChem CID | 167697350 |
| Molecular Formula | C8H16F3N3O3 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | tert-butyl (2S,3R)-2-azido-3-hydroxybutanoate;molecular fluorine;hydrofluoride |
| SMILES | C[C@@H](O)[C@H](N=[N+]=[N-])C(=O)OC(C)(C)C.F.FF |
| InChI | InChI=1S/C8H15N3O3.F2.FH/c1-5(12)6(10-11-9)7(13)14-8(2,3)4;1-2;/h5-6,12H,1-4H3;;1H/t5-,6+;;/m1../s1 |
| InChIKey | XVYGKGDLISETHT-PVNUIUKASA-N |
| XLogP | 2.38 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|