C38H52N4O3 — CID 167699172
(3S)-1-[(7S)-7-tert-butyl-5,6,7,8-tetrahydro-3H-pyrrolo[3,2-b]quinolin-2-yl]-5-(4-hydroxypiperidin-1-yl)-3-[3-(2-piperidin-3-ylacetyl)phenyl]pentan-1-one (PubChem CID 167699172) has the molecular formula C38H52N4O3 and a molecular weight of 612.86 g/mol. Its IUPAC name is (3S)-1-[(7S)-7-tert-butyl-5,6,7,8-tetrahydro-3H-pyrrolo[3,2-b]quinolin-2-yl]-5-(4-hydroxypiperidin-1-yl)-3-[3-(2-piperidin-3-ylacetyl)phenyl]pentan-1-one.
| Compound Name | (3S)-1-[(7S)-7-tert-butyl-5,6,7,8-tetrahydro-3H-pyrrolo[3,2-b]quinolin-2-yl]-5-(4-hydroxypiperidin-1-yl)-3-[3-(2-piperidin-3-ylacetyl)phenyl]pentan-1-one |
|---|---|
| PubChem CID | 167699172 |
| Molecular Formula | C38H52N4O3 |
| Molecular Weight | 612.86 g/mol |
| Exact Mass | 612.40 |
| IUPAC Name | (3S)-1-[(7S)-7-tert-butyl-5,6,7,8-tetrahydro-3H-pyrrolo[3,2-b]quinolin-2-yl]-5-(4-hydroxypiperidin-1-yl)-3-[3-(2-piperidin-3-ylacetyl)phenyl]pentan-1-one |
| SMILES | CC(C)(C)[C@H]1CCc2nc3c(cc2C1)N=C(C(=O)C[C@H](CCN1CCC(O)CC1)c1cccc(C(=O)CC2CCCNC2)c1)C3 |
| InChI | InChI=1S/C38H52N4O3/c1-38(2,3)30-9-10-32-29(20-30)21-33-34(40-32)23-35(41-33)37(45)22-27(11-15-42-16-12-31(43)13-17-42)26-7-4-8-28(19-26)36(44)18-25-6-5-14-39-24-25/h4,7-8,19,21,25,27,30-31,39,43H,5-6,9-18,20,22-24H2,1-3H3/t25?,27-,30-/m0/s1 |
| InChIKey | YCVCBQLEHLHWBZ-KVIWRLORSA-N |
| XLogP | 6.02 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.86 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |