C35H48N6O3S — CID 155320577
(7S)-7-tert-butyl-N-[3-(4-hydroxypiperidin-1-yl)-1-[3-(piperidin-3-ylcarbamoyl)phenyl]propyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide (PubChem CID 155320577) has the molecular formula C35H48N6O3S and a molecular weight of 632.88 g/mol. Its IUPAC name is (7S)-7-tert-butyl-N-[3-(4-hydroxypiperidin-1-yl)-1-[3-(piperidin-3-ylcarbamoyl)phenyl]propyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide.
| Compound Name | (7S)-7-tert-butyl-N-[3-(4-hydroxypiperidin-1-yl)-1-[3-(piperidin-3-ylcarbamoyl)phenyl]propyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 155320577 |
| Molecular Formula | C35H48N6O3S |
| Molecular Weight | 632.88 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | (7S)-7-tert-butyl-N-[3-(4-hydroxypiperidin-1-yl)-1-[3-(piperidin-3-ylcarbamoyl)phenyl]propyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2nc3sc(C(=O)NC(CCN4CCC(O)CC4)c4cccc(C(=O)NC5CCCNC5)c4)nc3cc2C1 |
| InChI | InChI=1S/C35H48N6O3S/c1-35(2,3)25-9-10-28-24(19-25)20-30-33(39-28)45-34(40-30)32(44)38-29(13-17-41-15-11-27(42)12-16-41)22-6-4-7-23(18-22)31(43)37-26-8-5-14-36-21-26/h4,6-7,18,20,25-27,29,36,42H,5,8-17,19,21H2,1-3H3,(H,37,43)(H,38,44)/t25-,26?,29?/m0/s1 |
| InChIKey | APWVDYCXGMFXLA-OIOREYSGSA-N |
| XLogP | 4.64 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.88 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |