C23H28N4OS — CID 11847822
N-[(1S)-2-amino-1-phenylethyl]-7-tert-butyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide (PubChem CID 11847822) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is N-[(1S)-2-amino-1-phenylethyl]-7-tert-butyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide.
| Compound Name | N-[(1S)-2-amino-1-phenylethyl]-7-tert-butyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 11847822 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[(1S)-2-amino-1-phenylethyl]-7-tert-butyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide |
| SMILES | CC(C)(C)C1CCc2nc3sc(C(=O)N[C@H](CN)c4ccccc4)nc3cc2C1 |
| InChI | InChI=1S/C23H28N4OS/c1-23(2,3)16-9-10-17-15(11-16)12-18-21(26-17)29-22(27-18)20(28)25-19(13-24)14-7-5-4-6-8-14/h4-8,12,16,19H,9-11,13,24H2,1-3H3,(H,25,28)/t16?,19-/m1/s1 |
| InChIKey | XRKCHIMVPMRQRN-LRTDYKAYSA-N |
| XLogP | 4.27 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |