C24H27N3O2S — CID 164934948
(7S)-7-tert-butyl-N-[(1R)-3-oxo-1-phenylpropyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide (PubChem CID 164934948) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is (7S)-7-tert-butyl-N-[(1R)-3-oxo-1-phenylpropyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide.
| Compound Name | (7S)-7-tert-butyl-N-[(1R)-3-oxo-1-phenylpropyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 164934948 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (7S)-7-tert-butyl-N-[(1R)-3-oxo-1-phenylpropyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2nc3sc(C(=O)N[C@H](CC=O)c4ccccc4)nc3cc2C1 |
| InChI | InChI=1S/C24H27N3O2S/c1-24(2,3)17-9-10-18-16(13-17)14-20-22(26-18)30-23(27-20)21(29)25-19(11-12-28)15-7-5-4-6-8-15/h4-8,12,14,17,19H,9-11,13H2,1-3H3,(H,25,29)/t17-,19+/m0/s1 |
| InChIKey | JGBZZPJDFXKVBC-PKOBYXMFSA-N |
| XLogP | 4.90 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|