C25H27BrN2O2S — CID 155321127
(6S)-N-[1-(4-bromophenyl)-3-oxopropyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 155321127) has the molecular formula C25H27BrN2O2S and a molecular weight of 499.47 g/mol. Its IUPAC name is (6S)-N-[1-(4-bromophenyl)-3-oxopropyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | (6S)-N-[1-(4-bromophenyl)-3-oxopropyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 155321127 |
| Molecular Formula | C25H27BrN2O2S |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | (6S)-N-[1-(4-bromophenyl)-3-oxopropyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2nc3sc(C(=O)NC(CC=O)c4ccc(Br)cc4)cc3cc2C1 |
| InChI | InChI=1S/C25H27BrN2O2S/c1-25(2,3)18-6-9-20-16(13-18)12-17-14-22(31-24(17)28-20)23(30)27-21(10-11-29)15-4-7-19(26)8-5-15/h4-5,7-8,11-12,14,18,21H,6,9-10,13H2,1-3H3,(H,27,30)/t18-,21?/m0/s1 |
| InChIKey | INPDMFHKQGHYKO-YMXDCFFPSA-N |
| XLogP | 6.27 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|