C32H39N3O4S2 — CID 158244889
6-tert-butyl-N-hydroxy-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide;6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxylic acid (PubChem CID 158244889) has the molecular formula C32H39N3O4S2 and a molecular weight of 593.82 g/mol. Its IUPAC name is 6-tert-butyl-N-hydroxy-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide;6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxylic acid.
| Compound Name | 6-tert-butyl-N-hydroxy-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide;6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 158244889 |
| Molecular Formula | C32H39N3O4S2 |
| Molecular Weight | 593.82 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | 6-tert-butyl-N-hydroxy-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide;6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxylic acid |
| SMILES | CC(C)(C)C1CCc2nc3sc(C(=O)NO)cc3cc2C1.CC(C)(C)C1CCc2nc3sc(C(=O)O)cc3cc2C1 |
| InChI | InChI=1S/C16H20N2O2S.C16H19NO2S/c1-16(2,3)11-4-5-12-9(7-11)6-10-8-13(14(19)18-20)21-15(10)17-12;1-16(2,3)11-4-5-12-9(7-11)6-10-8-13(15(18)19)20-14(10)17-12/h6,8,11,20H,4-5,7H2,1-3H3,(H,18,19);6,8,11H,4-5,7H2,1-3H3,(H,18,19) |
| InChIKey | GFZOQPDOPIIXTL-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.82 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|