C19H27N3OS — CID 143292446
2-(2-aminoethylamino)-1-(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl)ethanone (PubChem CID 143292446) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is 2-(2-aminoethylamino)-1-(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl)ethanone.
| Compound Name | 2-(2-aminoethylamino)-1-(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl)ethanone |
|---|---|
| PubChem CID | 143292446 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-(2-aminoethylamino)-1-(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl)ethanone |
| SMILES | CC(C)(C)C1CCc2nc3sc(C(=O)CNCCN)cc3cc2C1 |
| InChI | InChI=1S/C19H27N3OS/c1-19(2,3)14-4-5-15-12(9-14)8-13-10-17(24-18(13)22-15)16(23)11-21-7-6-20/h8,10,14,21H,4-7,9,11,20H2,1-3H3 |
| InChIKey | JSAKYJCQEHJDJE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|