C34H42N4O4S — CID 155320588
(6S)-N-[(1R)-3-[bis(2-hydroxyethyl)amino]-1-[4-(6-oxo-1H-pyridin-3-yl)phenyl]propyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 155320588) has the molecular formula C34H42N4O4S and a molecular weight of 602.80 g/mol. Its IUPAC name is (6S)-N-[(1R)-3-[bis(2-hydroxyethyl)amino]-1-[4-(6-oxo-1H-pyridin-3-yl)phenyl]propyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | (6S)-N-[(1R)-3-[bis(2-hydroxyethyl)amino]-1-[4-(6-oxo-1H-pyridin-3-yl)phenyl]propyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 155320588 |
| Molecular Formula | C34H42N4O4S |
| Molecular Weight | 602.80 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | (6S)-N-[(1R)-3-[bis(2-hydroxyethyl)amino]-1-[4-(6-oxo-1H-pyridin-3-yl)phenyl]propyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2nc3sc(C(=O)N[C@H](CCN(CCO)CCO)c4ccc(-c5ccc(=O)[nH]c5)cc4)cc3cc2C1 |
| InChI | InChI=1S/C34H42N4O4S/c1-34(2,3)27-9-10-28-25(19-27)18-26-20-30(43-33(26)37-28)32(42)36-29(12-13-38(14-16-39)15-17-40)23-6-4-22(5-7-23)24-8-11-31(41)35-21-24/h4-8,11,18,20-21,27,29,39-40H,9-10,12-17,19H2,1-3H3,(H,35,41)(H,36,42)/t27-,29+/m0/s1 |
| InChIKey | KIELBALMHUCRMM-LMSSTIIKSA-N |
| XLogP | 4.95 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.80 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |